C26H24N2O4 — CID 118887981
methyl 4-[(1S)-1-[[8-(4-methoxyphenoxy)isoquinolin-1-yl]amino]ethyl]benzoate (PubChem CID 118887981) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[8-(4-methoxyphenoxy)isoquinolin-1-yl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[8-(4-methoxyphenoxy)isoquinolin-1-yl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 118887981 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | methyl 4-[(1S)-1-[[8-(4-methoxyphenoxy)isoquinolin-1-yl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)Nc2nccc3cccc(Oc4ccc(OC)cc4)c23)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-17(18-7-9-20(10-8-18)26(29)31-3)28-25-24-19(15-16-27-25)5-4-6-23(24)32-22-13-11-21(30-2)12-14-22/h4-17H,1-3H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | VLNISZRFPIBMBE-KRWDZBQOSA-N |
| XLogP | 6.00 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |