C24H19FN2O3 — CID 118887997
4-[(1R)-1-[[8-(4-fluorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid (PubChem CID 118887997) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 4-[(1R)-1-[[8-(4-fluorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1R)-1-[[8-(4-fluorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 118887997 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-[(1R)-1-[[8-(4-fluorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid |
| SMILES | C[C@@H](Nc1nccc2cccc(Oc3ccc(F)cc3)c12)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H19FN2O3/c1-15(16-5-7-18(8-6-16)24(28)29)27-23-22-17(13-14-26-23)3-2-4-21(22)30-20-11-9-19(25)10-12-20/h2-15H,1H3,(H,26,27)(H,28,29)/t15-/m1/s1 |
| InChIKey | CAYSQJSKVXPSHL-OAHLLOKOSA-N |
| XLogP | 6.04 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |