C24H19ClN2O3 — CID 125468852
4-[(1S)-1-[[8-(2-chlorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid (PubChem CID 125468852) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is 4-[(1S)-1-[[8-(2-chlorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid.
| Compound Name | 4-[(1S)-1-[[8-(2-chlorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 125468852 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[(1S)-1-[[8-(2-chlorophenoxy)isoquinolin-1-yl]amino]ethyl]benzoic acid |
| SMILES | C[C@H](Nc1nccc2cccc(Oc3ccccc3Cl)c12)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H19ClN2O3/c1-15(16-9-11-18(12-10-16)24(28)29)27-23-22-17(13-14-26-23)5-4-8-21(22)30-20-7-3-2-6-19(20)25/h2-15H,1H3,(H,26,27)(H,28,29)/t15-/m0/s1 |
| InChIKey | YBCKKIFBEOFZFW-HNNXBMFYSA-N |
| XLogP | 6.55 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |