C26H23ClN2O2 — CID 118887970
methyl 4-[(1S)-1-[[8-[(3-chlorophenyl)methyl]isoquinolin-1-yl]amino]ethyl]benzoate (PubChem CID 118887970) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is methyl 4-[(1S)-1-[[8-[(3-chlorophenyl)methyl]isoquinolin-1-yl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[(1S)-1-[[8-[(3-chlorophenyl)methyl]isoquinolin-1-yl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 118887970 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | methyl 4-[(1S)-1-[[8-[(3-chlorophenyl)methyl]isoquinolin-1-yl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc([C@H](C)Nc2nccc3cccc(Cc4cccc(Cl)c4)c23)cc1 |
| InChI | InChI=1S/C26H23ClN2O2/c1-17(19-9-11-21(12-10-19)26(30)31-2)29-25-24-20(13-14-28-25)6-4-7-22(24)15-18-5-3-8-23(27)16-18/h3-14,16-17H,15H2,1-2H3,(H,28,29)/t17-/m0/s1 |
| InChIKey | WOXOVSBXNWZSSM-KRWDZBQOSA-N |
| XLogP | 6.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |