C22H20ClNO3S — CID 71129733
methyl 4-[1-[[4-[(3-chlorophenyl)methyl]thiophene-3-carbonyl]amino]ethyl]benzoate (PubChem CID 71129733) has the molecular formula C22H20ClNO3S and a molecular weight of 413.93 g/mol. Its IUPAC name is methyl 4-[1-[[4-[(3-chlorophenyl)methyl]thiophene-3-carbonyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[1-[[4-[(3-chlorophenyl)methyl]thiophene-3-carbonyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 71129733 |
| Molecular Formula | C22H20ClNO3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | methyl 4-[1-[[4-[(3-chlorophenyl)methyl]thiophene-3-carbonyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(C)NC(=O)c2cscc2Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H20ClNO3S/c1-14(16-6-8-17(9-7-16)22(26)27-2)24-21(25)20-13-28-12-18(20)10-15-4-3-5-19(23)11-15/h3-9,11-14H,10H2,1-2H3,(H,24,25) |
| InChIKey | OINKDQOUSMVWPZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |