C21H17Cl2NO3S — CID 24952575
4-[1-[[5-chloro-3-[(3-chlorophenyl)methyl]thiophene-2-carbonyl]amino]ethyl]benzoic acid (PubChem CID 24952575) has the molecular formula C21H17Cl2NO3S and a molecular weight of 434.34 g/mol. Its IUPAC name is 4-[1-[[5-chloro-3-[(3-chlorophenyl)methyl]thiophene-2-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[5-chloro-3-[(3-chlorophenyl)methyl]thiophene-2-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 24952575 |
| Molecular Formula | C21H17Cl2NO3S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 4-[1-[[5-chloro-3-[(3-chlorophenyl)methyl]thiophene-2-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)c1sc(Cl)cc1Cc1cccc(Cl)c1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H17Cl2NO3S/c1-12(14-5-7-15(8-6-14)21(26)27)24-20(25)19-16(11-18(23)28-19)9-13-3-2-4-17(22)10-13/h2-8,10-12H,9H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | NCZZPAVJNDIVAY-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |