C24H17F2N3O3 — CID 118888078
4-[1-[[3-fluoro-8-(3-fluorophenoxy)-2,7-naphthyridin-1-yl]amino]cyclopropyl]benzoic acid (PubChem CID 118888078) has the molecular formula C24H17F2N3O3 and a molecular weight of 433.41 g/mol. Its IUPAC name is 4-[1-[[3-fluoro-8-(3-fluorophenoxy)-2,7-naphthyridin-1-yl]amino]cyclopropyl]benzoic acid.
| Compound Name | 4-[1-[[3-fluoro-8-(3-fluorophenoxy)-2,7-naphthyridin-1-yl]amino]cyclopropyl]benzoic acid |
|---|---|
| PubChem CID | 118888078 |
| Molecular Formula | C24H17F2N3O3 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-[1-[[3-fluoro-8-(3-fluorophenoxy)-2,7-naphthyridin-1-yl]amino]cyclopropyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2(Nc3nc(F)cc4ccnc(Oc5cccc(F)c5)c34)CC2)cc1 |
| InChI | InChI=1S/C24H17F2N3O3/c25-17-2-1-3-18(13-17)32-22-20-15(8-11-27-22)12-19(26)28-21(20)29-24(9-10-24)16-6-4-14(5-7-16)23(30)31/h1-8,11-13H,9-10H2,(H,28,29)(H,30,31) |
| InChIKey | DLRKSWALFKKWAT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|