C20H14F2N2O4 — CID 69051381
4-[[[5-fluoro-2-(3-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid (PubChem CID 69051381) has the molecular formula C20H14F2N2O4 and a molecular weight of 384.34 g/mol. Its IUPAC name is 4-[[[5-fluoro-2-(3-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[5-fluoro-2-(3-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 69051381 |
| Molecular Formula | C20H14F2N2O4 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-[[[5-fluoro-2-(3-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cc(F)cnc2Oc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C20H14F2N2O4/c21-14-2-1-3-16(8-14)28-19-17(9-15(22)11-24-19)18(25)23-10-12-4-6-13(7-5-12)20(26)27/h1-9,11H,10H2,(H,23,25)(H,26,27) |
| InChIKey | XUISPUUCDQCKOO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |