C27H21FN2O5 — CID 91108177
4-[[[5-fluoro-2-(4-phenylmethoxyphenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid (PubChem CID 91108177) has the molecular formula C27H21FN2O5 and a molecular weight of 472.47 g/mol. Its IUPAC name is 4-[[[5-fluoro-2-(4-phenylmethoxyphenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[5-fluoro-2-(4-phenylmethoxyphenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 91108177 |
| Molecular Formula | C27H21FN2O5 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 4-[[[5-fluoro-2-(4-phenylmethoxyphenoxy)pyridine-3-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)c2cc(F)cnc2Oc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C27H21FN2O5/c28-21-14-24(25(31)29-15-18-6-8-20(9-7-18)27(32)33)26(30-16-21)35-23-12-10-22(11-13-23)34-17-19-4-2-1-3-5-19/h1-14,16H,15,17H2,(H,29,31)(H,32,33) |
| InChIKey | HZFZLSDFHIVSOO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |