C21H16F2N2O4 — CID 141335128
2-[[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]-3-methylbenzoic acid (PubChem CID 141335128) has the molecular formula C21H16F2N2O4 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-[[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]-3-methylbenzoic acid.
| Compound Name | 2-[[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 141335128 |
| Molecular Formula | C21H16F2N2O4 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[[[5-fluoro-2-(4-fluorophenoxy)pyridine-3-carbonyl]amino]methyl]-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1CNC(=O)c1cc(F)cnc1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C21H16F2N2O4/c1-12-3-2-4-16(21(27)28)18(12)11-24-19(26)17-9-14(23)10-25-20(17)29-15-7-5-13(22)6-8-15/h2-10H,11H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | OEHUYHXYUHXPKZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |