C18H20N4O2 — CID 118888506
1'-(4-amino-3-methoxyphenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (PubChem CID 118888506) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1'-(4-amino-3-methoxyphenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one.
| Compound Name | 1'-(4-amino-3-methoxyphenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 118888506 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1'-(4-amino-3-methoxyphenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| SMILES | COc1cc(N2CCC3(CC2)C(=O)Nc2ncccc23)ccc1N |
| InChI | InChI=1S/C18H20N4O2/c1-24-15-11-12(4-5-14(15)19)22-9-6-18(7-10-22)13-3-2-8-20-16(13)21-17(18)23/h2-5,8,11H,6-7,9-10,19H2,1H3,(H,20,21,23) |
| InChIKey | SRJLAVVPCBJFHZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|