C11H14N4O — CID 70997318
1'-aminospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (PubChem CID 70997318) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 1'-aminospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one.
| Compound Name | 1'-aminospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 70997318 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1'-aminospiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| SMILES | NN1CCC2(CC1)C(=O)Nc1ncccc12 |
| InChI | InChI=1S/C11H14N4O/c12-15-6-3-11(4-7-15)8-2-1-5-13-9(8)14-10(11)16/h1-2,5H,3-4,6-7,12H2,(H,13,14,16) |
| InChIKey | TULBPLVRCOEFQC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|