C17H17FN4O — CID 118888513
1'-(4-amino-3-fluorophenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (PubChem CID 118888513) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 1'-(4-amino-3-fluorophenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one.
| Compound Name | 1'-(4-amino-3-fluorophenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 118888513 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1'-(4-amino-3-fluorophenyl)spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| SMILES | Nc1ccc(N2CCC3(CC2)C(=O)Nc2ncccc23)cc1F |
| InChI | InChI=1S/C17H17FN4O/c18-13-10-11(3-4-14(13)19)22-8-5-17(6-9-22)12-2-1-7-20-15(12)21-16(17)23/h1-4,7,10H,5-6,8-9,19H2,(H,20,21,23) |
| InChIKey | UBCRDABHBAQWJN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|