C26H21F5N4O3 — CID 11848649
1'-[2-[5-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]acetyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one (PubChem CID 11848649) has the molecular formula C26H21F5N4O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is 1'-[2-[5-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]acetyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one.
| Compound Name | 1'-[2-[5-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]acetyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 11848649 |
| Molecular Formula | C26H21F5N4O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 1'-[2-[5-(2,3-difluorophenyl)-2-oxo-1-(2,2,2-trifluoroethyl)-3-pyridinyl]acetyl]spiro[1H-pyrrolo[2,3-b]pyridine-3,4'-piperidine]-2-one |
| SMILES | O=C(Cc1cc(-c2cccc(F)c2F)cn(CC(F)(F)F)c1=O)N1CCC2(CC1)C(=O)Nc1ncccc12 |
| InChI | InChI=1S/C26H21F5N4O3/c27-19-5-1-3-17(21(19)28)16-11-15(23(37)35(13-16)14-26(29,30)31)12-20(36)34-9-6-25(7-10-34)18-4-2-8-32-22(18)33-24(25)38/h1-5,8,11,13H,6-7,9-10,12,14H2,(H,32,33,38) |
| InChIKey | ACHJAMHZGHHARP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |