C19H28N6+2 — CID 11888904
4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine (PubChem CID 11888904) has the molecular formula C19H28N6+2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine.
| Compound Name | 4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 11888904 |
| Molecular Formula | C19H28N6+2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
| SMILES | Cc1nc(NC2=[NH+]C[NH+]([C@@H]3CCCC[C@@H]3C)CN2)nc2ccccc12 |
| InChI | InChI=1S/C19H26N6/c1-13-7-3-6-10-17(13)25-11-20-18(21-12-25)24-19-22-14(2)15-8-4-5-9-16(15)23-19/h4-5,8-9,13,17H,3,6-7,10-12H2,1-2H3,(H2,20,21,22,23,24)/p+2/t13-,17+/m0/s1 |
| InChIKey | NEEOQUZPWWKPOF-SUMWQHHRSA-P |
| XLogP | -0.23 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |