C18H26N6O2+2 — CID 6965861
6-methoxy-4-methyl-N-[3-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine (PubChem CID 6965861) has the molecular formula C18H26N6O2+2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 6-methoxy-4-methyl-N-[3-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine.
| Compound Name | 6-methoxy-4-methyl-N-[3-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 6965861 |
| Molecular Formula | C18H26N6O2+2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 6-methoxy-4-methyl-N-[3-[[(2R)-oxolan-2-yl]methyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
| SMILES | COc1ccc2nc(NC3=[NH+]C[NH+](C[C@H]4CCCO4)CN3)nc(C)c2c1 |
| InChI | InChI=1S/C18H24N6O2/c1-12-15-8-13(25-2)5-6-16(15)22-18(21-12)23-17-19-10-24(11-20-17)9-14-4-3-7-26-14/h5-6,8,14H,3-4,7,9-11H2,1-2H3,(H2,19,20,21,22,23)/p+2/t14-/m1/s1 |
| InChIKey | BDNPTTURBQFPIJ-CQSZACIVSA-P |
| XLogP | -1.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |