C21H32N6O+2 — CID 7011751
6-ethoxy-4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine (PubChem CID 7011751) has the molecular formula C21H32N6O+2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 6-ethoxy-4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine.
| Compound Name | 6-ethoxy-4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
|---|---|
| PubChem CID | 7011751 |
| Molecular Formula | C21H32N6O+2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 6-ethoxy-4-methyl-N-[3-[(1R,2S)-2-methylcyclohexyl]-1,2,3,4-tetrahydro-1,3,5-triazine-3,5-diium-6-yl]quinazolin-2-amine |
| SMILES | CCOc1ccc2nc(NC3=[NH+]C[NH+]([C@@H]4CCCC[C@@H]4C)CN3)nc(C)c2c1 |
| InChI | InChI=1S/C21H30N6O/c1-4-28-16-9-10-18-17(11-16)15(3)24-21(25-18)26-20-22-12-27(13-23-20)19-8-6-5-7-14(19)2/h9-11,14,19H,4-8,12-13H2,1-3H3,(H2,22,23,24,25,26)/p+2/t14-,19+/m0/s1 |
| InChIKey | YOFZYRBTBVRWFU-IFXJQAMLSA-P |
| XLogP | 0.17 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |