C19H28N4O2S — CID 11888986
[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 11888986) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 11888986 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | Cc1cc(C)n2nc(SCC(=O)O[C@@H]3C[C@@H](C)CC[C@@H]3C(C)C)nc2n1 |
| InChI | InChI=1S/C19H28N4O2S/c1-11(2)15-7-6-12(3)8-16(15)25-17(24)10-26-19-21-18-20-13(4)9-14(5)23(18)22-19/h9,11-12,15-16H,6-8,10H2,1-5H3/t12-,15+,16+/m0/s1 |
| InChIKey | APFGEEUAJCMESF-APHBMKBZSA-N |
| XLogP | 3.84 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |