C9H19N3O3 — CID 118890371
methyl N-[(3S,4R)-3,4-diamino-4-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 118890371) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl N-[(3S,4R)-3,4-diamino-4-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | methyl N-[(3S,4R)-3,4-diamino-4-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 118890371 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | methyl N-[(3S,4R)-3,4-diamino-4-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CC[C@@](C)(N)[C@](N)(NC(=O)OC)C(C)=O |
| InChI | InChI=1S/C9H19N3O3/c1-5-8(3,10)9(11,6(2)13)12-7(14)15-4/h5,10-11H2,1-4H3,(H,12,14)/t8-,9-/m1/s1 |
| InChIKey | PRSJCSKJDMOESQ-RKDXNWHRSA-N |
| XLogP | -0.29 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|