C12H24N4O4 — CID 21431320
methyl N-[2-[(E)-2-(methoxycarbonylamino)butan-2-yldiazenyl]butan-2-yl]carbamate (PubChem CID 21431320) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl N-[2-[(E)-2-(methoxycarbonylamino)butan-2-yldiazenyl]butan-2-yl]carbamate.
| Compound Name | methyl N-[2-[(E)-2-(methoxycarbonylamino)butan-2-yldiazenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 21431320 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | methyl N-[2-[(E)-2-(methoxycarbonylamino)butan-2-yldiazenyl]butan-2-yl]carbamate |
| SMILES | CCC(C)(/N=N/C(C)(CC)NC(=O)OC)NC(=O)OC |
| InChI | InChI=1S/C12H24N4O4/c1-7-11(3,13-9(17)19-5)15-16-12(4,8-2)14-10(18)20-6/h7-8H2,1-6H3,(H,13,17)(H,14,18)/b16-15+ |
| InChIKey | DZQHCEUJDPSBKQ-FOCLMDBBSA-N |
| XLogP | 2.40 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|