C20H26N4O2 — CID 118893228
N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-5-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide (PubChem CID 118893228) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-5-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-5-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 118893228 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]-5-phenyl-3,4-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC(C)CC(NC(=O)N1C=C(c2ccccc2)CCC1)C(=O)NCC#N |
| InChI | InChI=1S/C20H26N4O2/c1-15(2)13-18(19(25)22-11-10-21)23-20(26)24-12-6-9-17(14-24)16-7-4-3-5-8-16/h3-5,7-8,14-15,18H,6,9,11-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | OIVZBTMMNZXTDI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|