C22H31FN4O2 — CID 145020504
N-(cyanomethyl)-2-formamido-4-methylpentanamide;5-(2-fluoro-5-methylphenyl)-1-methyl-3,4-dihydro-2H-pyridine (PubChem CID 145020504) has the molecular formula C22H31FN4O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is N-(cyanomethyl)-2-formamido-4-methylpentanamide;5-(2-fluoro-5-methylphenyl)-1-methyl-3,4-dihydro-2H-pyridine.
| Compound Name | N-(cyanomethyl)-2-formamido-4-methylpentanamide;5-(2-fluoro-5-methylphenyl)-1-methyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 145020504 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | N-(cyanomethyl)-2-formamido-4-methylpentanamide;5-(2-fluoro-5-methylphenyl)-1-methyl-3,4-dihydro-2H-pyridine |
| SMILES | CC(C)CC(NC=O)C(=O)NCC#N.Cc1ccc(F)c(C2=CN(C)CCC2)c1 |
| InChI | InChI=1S/C13H16FN.C9H15N3O2/c1-10-5-6-13(14)12(8-10)11-4-3-7-15(2)9-11;1-7(2)5-8(12-6-13)9(14)11-4-3-10/h5-6,8-9H,3-4,7H2,1-2H3;6-8H,4-5H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | BBFVVIFGEGQENG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|