C25H21BrClF4N3O5 — CID 118898919
6-(aminomethyl)-7-bromo-2-[(3-chloro-4-fluorophenyl)methyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione;2,2,2-trifluoroacetic acid (PubChem CID 118898919) has the molecular formula C25H21BrClF4N3O5 and a molecular weight of 634.81 g/mol. Its IUPAC name is 6-(aminomethyl)-7-bromo-2-[(3-chloro-4-fluorophenyl)methyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(aminomethyl)-7-bromo-2-[(3-chloro-4-fluorophenyl)methyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118898919 |
| Molecular Formula | C25H21BrClF4N3O5 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 633.03 |
| IUPAC Name | 6-(aminomethyl)-7-bromo-2-[(3-chloro-4-fluorophenyl)methyl]-9-phenylmethoxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCc1c(Br)c(=O)c(OCc2ccccc2)c2n1CCN(Cc1ccc(F)c(Cl)c1)C2=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H20BrClFN3O3.C2HF3O2/c24-19-18(11-27)29-9-8-28(12-15-6-7-17(26)16(25)10-15)23(31)20(29)22(21(19)30)32-13-14-4-2-1-3-5-14;3-2(4,5)1(6)7/h1-7,10H,8-9,11-13,27H2;(H,6,7) |
| InChIKey | CJPXUGMYEWPJRV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |