C19H19BrClFN2O3 — CID 71082224
7-bromo-9-butoxy-2-[(3-chloro-4-fluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 71082224) has the molecular formula C19H19BrClFN2O3 and a molecular weight of 457.73 g/mol. Its IUPAC name is 7-bromo-9-butoxy-2-[(3-chloro-4-fluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 7-bromo-9-butoxy-2-[(3-chloro-4-fluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 71082224 |
| Molecular Formula | C19H19BrClFN2O3 |
| Molecular Weight | 457.73 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 7-bromo-9-butoxy-2-[(3-chloro-4-fluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | CCCCOc1c2n(cc(Br)c1=O)CCN(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C19H19BrClFN2O3/c1-2-3-8-27-18-16-19(26)24(7-6-23(16)11-13(20)17(18)25)10-12-4-5-15(22)14(21)9-12/h4-5,9,11H,2-3,6-8,10H2,1H3 |
| InChIKey | BJNIJDOYEYIBRN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|