C18H27N2O3+ — CID 11889965
[(Z)-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]amino] 4-propoxybenzoate (PubChem CID 11889965) has the molecular formula C18H27N2O3+ and a molecular weight of 319.43 g/mol. Its IUPAC name is [(Z)-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]amino] 4-propoxybenzoate.
| Compound Name | [(Z)-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]amino] 4-propoxybenzoate |
|---|---|
| PubChem CID | 11889965 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | [(Z)-[(2R,5S)-1,2,5-trimethylpiperidin-1-ium-4-ylidene]amino] 4-propoxybenzoate |
| SMILES | CCCOc1ccc(C(=O)O/N=C2/C[C@@H](C)[NH+](C)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-5-10-22-16-8-6-15(7-9-16)18(21)23-19-17-11-14(3)20(4)12-13(17)2/h6-9,13-14H,5,10-12H2,1-4H3/p+1/b19-17-/t13-,14+/m0/s1 |
| InChIKey | SZLKYLKGKTXXLR-NFPAXOPASA-O |
| XLogP | 1.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|