C19H26N2O — CID 118900112
N-[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide (PubChem CID 118900112) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118900112 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[(2S,4aR)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-4-carboxamide |
| SMILES | CC1CC=C2C[C@@H](NC(=O)c3ccncc3)CC[C@]2(C)C1C |
| InChI | InChI=1S/C19H26N2O/c1-13-4-5-16-12-17(6-9-19(16,3)14(13)2)21-18(22)15-7-10-20-11-8-15/h5,7-8,10-11,13-14,17H,4,6,9,12H2,1-3H3,(H,21,22)/t13?,14?,17-,19+/m0/s1 |
| InChIKey | VUGYKENLNRTQPS-PLQDADFZSA-N |
| XLogP | 3.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|