C17H24N2S2 — CID 130177849
[(2S,4aR,6S)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbodithioate (PubChem CID 130177849) has the molecular formula C17H24N2S2 and a molecular weight of 320.53 g/mol. Its IUPAC name is [(2S,4aR,6S)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbodithioate.
| Compound Name | [(2S,4aR,6S)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbodithioate |
|---|---|
| PubChem CID | 130177849 |
| Molecular Formula | C17H24N2S2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [(2S,4aR,6S)-4a,5,6-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbodithioate |
| SMILES | CC1[C@@H](C)CC=C2C[C@@H](SC(=S)n3ccnc3)CC[C@@]21C |
| InChI | InChI=1S/C17H24N2S2/c1-12-4-5-14-10-15(6-7-17(14,3)13(12)2)21-16(20)19-9-8-18-11-19/h5,8-9,11-13,15H,4,6-7,10H2,1-3H3/t12-,13?,15-,17+/m0/s1 |
| InChIKey | FYVQERGJVFQYLJ-WBOISGGTSA-N |
| XLogP | 4.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|