C16H21IN2OS — CID 167244401
O-[(2S,4aR)-6-iodo-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbothioate (PubChem CID 167244401) has the molecular formula C16H21IN2OS and a molecular weight of 416.33 g/mol. Its IUPAC name is O-[(2S,4aR)-6-iodo-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbothioate.
| Compound Name | O-[(2S,4aR)-6-iodo-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 167244401 |
| Molecular Formula | C16H21IN2OS |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | O-[(2S,4aR)-6-iodo-4a,5-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl] imidazole-1-carbothioate |
| SMILES | CC1C(I)CC=C2C[C@@H](OC(=S)n3ccnc3)CC[C@@]21C |
| InChI | InChI=1S/C16H21IN2OS/c1-11-14(17)4-3-12-9-13(5-6-16(11,12)2)20-15(21)19-8-7-18-10-19/h3,7-8,10-11,13-14H,4-6,9H2,1-2H3/t11?,13-,14?,16+/m0/s1 |
| InChIKey | UROBYIAZIWWXHG-XABSGNMRSA-N |
| XLogP | 4.36 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|