C15H22N2O2 — CID 145057025
(4,4-dimethyl-3-propan-2-ylidenecyclohexyl) imidazole-1-carboxylate (PubChem CID 145057025) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (4,4-dimethyl-3-propan-2-ylidenecyclohexyl) imidazole-1-carboxylate.
| Compound Name | (4,4-dimethyl-3-propan-2-ylidenecyclohexyl) imidazole-1-carboxylate |
|---|---|
| PubChem CID | 145057025 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (4,4-dimethyl-3-propan-2-ylidenecyclohexyl) imidazole-1-carboxylate |
| SMILES | CC(C)=C1CC(OC(=O)n2ccnc2)CCC1(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-11(2)13-9-12(5-6-15(13,3)4)19-14(18)17-8-7-16-10-17/h7-8,10,12H,5-6,9H2,1-4H3 |
| InChIKey | QBGOCVBYFVDYJJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|