C23H34N2O — CID 118894097
N-[(2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide (PubChem CID 118894097) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is N-[(2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide.
| Compound Name | N-[(2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118894097 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | N-[(2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]pyridine-2-carboxamide |
| SMILES | CC(C)C1CC=C2C[C@@H](NC(=O)c3ccccn3)CC[C@]2(C)C1C(C)C |
| InChI | InChI=1S/C23H34N2O/c1-15(2)19-10-9-17-14-18(11-12-23(17,5)21(19)16(3)4)25-22(26)20-8-6-7-13-24-20/h6-9,13,15-16,18-19,21H,10-12,14H2,1-5H3,(H,25,26)/t18-,19?,21?,23-/m0/s1 |
| InChIKey | RMXACDBBTXQRSJ-UETMWJFSSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|