C24H38N2OSi — CID 155618824
N-[3-[2-tri(propan-2-yl)silylethynyl]cycloheptyl]pyridine-2-carboxamide (PubChem CID 155618824) has the molecular formula C24H38N2OSi and a molecular weight of 398.67 g/mol. Its IUPAC name is N-[3-[2-tri(propan-2-yl)silylethynyl]cycloheptyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[2-tri(propan-2-yl)silylethynyl]cycloheptyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155618824 |
| Molecular Formula | C24H38N2OSi |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | N-[3-[2-tri(propan-2-yl)silylethynyl]cycloheptyl]pyridine-2-carboxamide |
| SMILES | CC(C)[Si](C#CC1CCCCC(NC(=O)c2ccccn2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H38N2OSi/c1-18(2)28(19(3)4,20(5)6)16-14-21-11-7-8-12-22(17-21)26-24(27)23-13-9-10-15-25-23/h9-10,13,15,18-22H,7-8,11-12,17H2,1-6H3,(H,26,27) |
| InChIKey | YARNZYNTGNKPLX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|