C27H38N2OSi — CID 155618819
N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]quinoline-2-carboxamide (PubChem CID 155618819) has the molecular formula C27H38N2OSi and a molecular weight of 434.70 g/mol. Its IUPAC name is N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]quinoline-2-carboxamide.
| Compound Name | N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155618819 |
| Molecular Formula | C27H38N2OSi |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]quinoline-2-carboxamide |
| SMILES | CC(C)[Si](C#CC1CCCC(NC(=O)c2ccc3ccccc3n2)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H38N2OSi/c1-19(2)31(20(3)4,21(5)6)17-16-22-10-9-12-24(18-22)28-27(30)26-15-14-23-11-7-8-13-25(23)29-26/h7-8,11,13-15,19-22,24H,9-10,12,18H2,1-6H3,(H,28,30) |
| InChIKey | DEJUUDDZTMGASL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|