C26H39N3OSi — CID 155618833
1-methyl-N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]indazole-3-carboxamide (PubChem CID 155618833) has the molecular formula C26H39N3OSi and a molecular weight of 437.70 g/mol. Its IUPAC name is 1-methyl-N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]indazole-3-carboxamide.
| Compound Name | 1-methyl-N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 155618833 |
| Molecular Formula | C26H39N3OSi |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.29 |
| IUPAC Name | 1-methyl-N-[3-[2-tri(propan-2-yl)silylethynyl]cyclohexyl]indazole-3-carboxamide |
| SMILES | CC(C)[Si](C#CC1CCCC(NC(=O)c2nn(C)c3ccccc23)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H39N3OSi/c1-18(2)31(19(3)4,20(5)6)16-15-21-11-10-12-22(17-21)27-26(30)25-23-13-8-9-14-24(23)29(7)28-25/h8-9,13-14,18-22H,10-12,17H2,1-7H3,(H,27,30) |
| InChIKey | OTIICYQXZNWXLQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|