C18H26N4O5S — CID 46912690
1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide;sulfuric acid (PubChem CID 46912690) has the molecular formula C18H26N4O5S and a molecular weight of 410.50 g/mol. Its IUPAC name is 1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide;sulfuric acid.
| Compound Name | 1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 46912690 |
| Molecular Formula | C18H26N4O5S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide;sulfuric acid |
| SMILES | CN1[C@H]2CCC[C@H]1CC(NC(=O)c1nn(C)c3ccccc13)C2.O=S(=O)(O)O |
| InChI | InChI=1S/C18H24N4O.H2O4S/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17;1-5(2,3)4/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23);(H2,1,2,3,4)/t13-,14-;/m0./s1 |
| InChIKey | VUNAXEUVVQKXFK-IODNYQNNSA-N |
| XLogP | 1.67 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|