C18H24N4O7 — CID 91292940
1-(trihydroxymethyl)-N-[9-(trihydroxymethyl)-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide (PubChem CID 91292940) has the molecular formula C18H24N4O7 and a molecular weight of 408.41 g/mol. Its IUPAC name is 1-(trihydroxymethyl)-N-[9-(trihydroxymethyl)-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide.
| Compound Name | 1-(trihydroxymethyl)-N-[9-(trihydroxymethyl)-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 91292940 |
| Molecular Formula | C18H24N4O7 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 1-(trihydroxymethyl)-N-[9-(trihydroxymethyl)-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide |
| SMILES | O=C(NC1CC2CCCC(C1)N2C(O)(O)O)c1nn(C(O)(O)O)c2ccccc12 |
| InChI | InChI=1S/C18H24N4O7/c23-16(15-13-6-1-2-7-14(13)22(20-15)18(27,28)29)19-10-8-11-4-3-5-12(9-10)21(11)17(24,25)26/h1-2,6-7,10-12,24-29H,3-5,8-9H2,(H,19,23) |
| InChIKey | BYFJDDGGQLODFY-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 171.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|