C18H24N4O9 — CID 91204879
N-(2,2,3,4,4-pentahydroxy-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1-(trihydroxymethyl)indazole-3-carboxamide (PubChem CID 91204879) has the molecular formula C18H24N4O9 and a molecular weight of 440.41 g/mol. Its IUPAC name is N-(2,2,3,4,4-pentahydroxy-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1-(trihydroxymethyl)indazole-3-carboxamide.
| Compound Name | N-(2,2,3,4,4-pentahydroxy-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1-(trihydroxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 91204879 |
| Molecular Formula | C18H24N4O9 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-(2,2,3,4,4-pentahydroxy-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)-1-(trihydroxymethyl)indazole-3-carboxamide |
| SMILES | CN1C2CCCC1C(O)(O)C(O)(NC(=O)c1nn(C(O)(O)O)c3ccccc13)C2(O)O |
| InChI | InChI=1S/C18H24N4O9/c1-21-11-7-4-8-12(21)16(26,27)17(28,15(11,24)25)19-14(23)13-9-5-2-3-6-10(9)22(20-13)18(29,30)31/h2-3,5-6,11-12,24-31H,4,7-8H2,1H3,(H,19,23) |
| InChIKey | YBJGGXSXTQPAJP-UHFFFAOYSA-N |
| XLogP | -3.77 |
| TPSA | 212.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|