C19H28N4O4S — CID 71728255
methanesulfonic acid;1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide (PubChem CID 71728255) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is methanesulfonic acid;1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide.
| Compound Name | methanesulfonic acid;1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 71728255 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | methanesulfonic acid;1-methyl-N-[(1S,5S)-9-methyl-9-azabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide |
| SMILES | CN1[C@H]2CCC[C@H]1CC(NC(=O)c1nn(C)c3ccccc13)C2.CS(=O)(=O)O |
| InChI | InChI=1S/C18H24N4O.CH4O3S/c1-21-13-6-5-7-14(21)11-12(10-13)19-18(23)17-15-8-3-4-9-16(15)22(2)20-17;1-5(2,3)4/h3-4,8-9,12-14H,5-7,10-11H2,1-2H3,(H,19,23);1H3,(H,2,3,4)/t13-,14-;/m0./s1 |
| InChIKey | CMSAAWFVVXRNTO-IODNYQNNSA-N |
| XLogP | 1.82 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|