C17H30S — CID 118894081
(2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-thiol (PubChem CID 118894081) has the molecular formula C17H30S and a molecular weight of 266.49 g/mol. Its IUPAC name is (2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-thiol.
| Compound Name | (2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-thiol |
|---|---|
| PubChem CID | 118894081 |
| Molecular Formula | C17H30S |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | (2S,4aR)-4a-methyl-5,6-di(propan-2-yl)-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-thiol |
| SMILES | CC(C)C1CC=C2C[C@@H](S)CC[C@]2(C)C1C(C)C |
| InChI | InChI=1S/C17H30S/c1-11(2)15-7-6-13-10-14(18)8-9-17(13,5)16(15)12(3)4/h6,11-12,14-16,18H,7-10H2,1-5H3/t14-,15?,16?,17-/m0/s1 |
| InChIKey | IFPUPBJKNJTXKA-OTBWCIGPSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|