C29H52S — CID 145350765
10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-thiol;2-methylpropane (PubChem CID 145350765) has the molecular formula C29H52S and a molecular weight of 432.80 g/mol. Its IUPAC name is 10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-thiol;2-methylpropane.
| Compound Name | 10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-thiol;2-methylpropane |
|---|---|
| PubChem CID | 145350765 |
| Molecular Formula | C29H52S |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 432.38 |
| IUPAC Name | 10,13-dimethyl-17-(4-methylpentan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-thiol;2-methylpropane |
| SMILES | CC(C)C.CC(C)CC(C)C1CCC2C3CC=C4CC(S)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C25H42S.C4H10/c1-16(2)14-17(3)21-8-9-22-20-7-6-18-15-19(26)10-12-24(18,4)23(20)11-13-25(21,22)5;1-4(2)3/h6,16-17,19-23,26H,7-15H2,1-5H3;4H,1-3H3 |
| InChIKey | ZZFKBGUDUNIIMT-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|