C15H30 — CID 166560829
1,1-dimethyl-3,4-di(propan-2-yl)cycloheptane (PubChem CID 166560829) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 1,1-dimethyl-3,4-di(propan-2-yl)cycloheptane.
| Compound Name | 1,1-dimethyl-3,4-di(propan-2-yl)cycloheptane |
|---|---|
| PubChem CID | 166560829 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 1,1-dimethyl-3,4-di(propan-2-yl)cycloheptane |
| SMILES | CC(C)C1CCCC(C)(C)CC1C(C)C |
| InChI | InChI=1S/C15H30/c1-11(2)13-8-7-9-15(5,6)10-14(13)12(3)4/h11-14H,7-10H2,1-6H3 |
| InChIKey | OQJYTYJAJHUXAY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |