C16H30 — CID 140631430
8,9-di(propan-2-yl)spiro[4.5]decane (PubChem CID 140631430) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 8,9-di(propan-2-yl)spiro[4.5]decane.
| Compound Name | 8,9-di(propan-2-yl)spiro[4.5]decane |
|---|---|
| PubChem CID | 140631430 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 8,9-di(propan-2-yl)spiro[4.5]decane |
| SMILES | CC(C)C1CCC2(CCCC2)CC1C(C)C |
| InChI | InChI=1S/C16H30/c1-12(2)14-7-10-16(8-5-6-9-16)11-15(14)13(3)4/h12-15H,5-11H2,1-4H3 |
| InChIKey | XVVOBTJRJRHCST-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |