C13H23NO9 — CID 118900602
[(2S,3S,4S,5R,6R)-2-[2-(2-acetamidoethoxy)ethoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] formate (PubChem CID 118900602) has the molecular formula C13H23NO9 and a molecular weight of 337.33 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6R)-2-[2-(2-acetamidoethoxy)ethoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] formate.
| Compound Name | [(2S,3S,4S,5R,6R)-2-[2-(2-acetamidoethoxy)ethoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] formate |
|---|---|
| PubChem CID | 118900602 |
| Molecular Formula | C13H23NO9 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [(2S,3S,4S,5R,6R)-2-[2-(2-acetamidoethoxy)ethoxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] formate |
| SMILES | CC(=O)NCCOCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](OC=O)[C@@H]1O |
| InChI | InChI=1S/C13H23NO9/c1-8(17)14-2-3-20-4-5-21-13-11(19)12(22-7-16)10(18)9(6-15)23-13/h7,9-13,15,18-19H,2-6H2,1H3,(H,14,17)/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | SKQXJPDPGAHOLH-BNDIWNMDSA-N |
| XLogP | -2.86 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|