C15H26N2O9 — CID 140764536
[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]oxan-3-yl]carbamic acid (PubChem CID 140764536) has the molecular formula C15H26N2O9 and a molecular weight of 378.38 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]oxan-3-yl]carbamic acid.
| Compound Name | [(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]oxan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 140764536 |
| Molecular Formula | C15H26N2O9 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[2-(2-methylprop-2-enoylamino)ethoxy]ethoxy]oxan-3-yl]carbamic acid |
| SMILES | C=C(C)C(=O)NCCOCCO[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1NC(=O)O |
| InChI | InChI=1S/C15H26N2O9/c1-8(2)13(21)16-3-4-24-5-6-25-14-10(17-15(22)23)12(20)11(19)9(7-18)26-14/h9-12,14,17-20H,1,3-7H2,2H3,(H,16,21)(H,22,23)/t9-,10-,11-,12-,14-/m0/s1 |
| InChIKey | FRHKQYOKURHSEU-JNLQPACOSA-N |
| XLogP | -2.21 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|