C17H29NO8 — CID 157364198
N-[(2R,4R,5R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]oxan-3-yl]acetamide (PubChem CID 157364198) has the molecular formula C17H29NO8 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-[(2R,4R,5R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]oxan-3-yl]acetamide.
| Compound Name | N-[(2R,4R,5R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 157364198 |
| Molecular Formula | C17H29NO8 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(2R,4R,5R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-(5-methyl-4-oxohex-5-enoxy)ethoxy]oxan-3-yl]acetamide |
| SMILES | C=C(C)C(=O)CCCOCCO[C@@H]1OC(CO)[C@H](O)[C@H](O)C1NC(C)=O |
| InChI | InChI=1S/C17H29NO8/c1-10(2)12(21)5-4-6-24-7-8-25-17-14(18-11(3)20)16(23)15(22)13(9-19)26-17/h13-17,19,22-23H,1,4-9H2,2-3H3,(H,18,20)/t13?,14?,15-,16+,17+/m0/s1 |
| InChIKey | AHSYANHBVOPIAK-IRKLFDGPSA-N |
| XLogP | -1.11 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|