C21H31N4O9+ — CID 159263882
4-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethylcarbamoyl]benzenediazonium (PubChem CID 159263882) has the molecular formula C21H31N4O9+ and a molecular weight of 483.50 g/mol. Its IUPAC name is 4-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethylcarbamoyl]benzenediazonium.
| Compound Name | 4-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethylcarbamoyl]benzenediazonium |
|---|---|
| PubChem CID | 159263882 |
| Molecular Formula | C21H31N4O9+ |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 4-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethylcarbamoyl]benzenediazonium |
| SMILES | CC(=O)NC1[C@H](OCCOCCOCCNC(=O)c2ccc([N+]#N)cc2)OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H30N4O9/c1-13(27)24-17-19(29)18(28)16(12-26)34-21(17)33-11-10-32-9-8-31-7-6-23-20(30)14-2-4-15(25-22)5-3-14/h2-5,16-19,21,26,28-29H,6-12H2,1H3,(H-,23,24,27,30)/p+1/t16?,17?,18-,19+,21+/m0/s1 |
| InChIKey | SIILNYUPXICQLY-MFCDAZRJSA-O |
| XLogP | -1.11 |
| TPSA | 183.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|