C25H35N3O9 — CID 161183824
N-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]-6-aminonaphthalene-2-carboxamide (PubChem CID 161183824) has the molecular formula C25H35N3O9 and a molecular weight of 521.57 g/mol. Its IUPAC name is N-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]-6-aminonaphthalene-2-carboxamide.
| Compound Name | N-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]-6-aminonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 161183824 |
| Molecular Formula | C25H35N3O9 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[2-[2-[2-[(2R,4R,5R)-3-acetamido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]ethoxy]ethyl]-6-aminonaphthalene-2-carboxamide |
| SMILES | CC(=O)NC1[C@H](OCCOCCOCCNC(=O)c2ccc3cc(N)ccc3c2)OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H35N3O9/c1-15(30)28-21-23(32)22(31)20(14-29)37-25(21)36-11-10-35-9-8-34-7-6-27-24(33)18-3-2-17-13-19(26)5-4-16(17)12-18/h2-5,12-13,20-23,25,29,31-32H,6-11,14,26H2,1H3,(H,27,33)(H,28,30)/t20?,21?,22-,23+,25+/m0/s1 |
| InChIKey | SATICVTZEVWCPG-CZSZLTFBSA-N |
| XLogP | -0.85 |
| TPSA | 181.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|