C23H16F8O2 — CID 118900621
2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(1,7,8-trifluoro-6-methylnaphthalen-2-yl)oxane (PubChem CID 118900621) has the molecular formula C23H16F8O2 and a molecular weight of 476.36 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(1,7,8-trifluoro-6-methylnaphthalen-2-yl)oxane.
| Compound Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(1,7,8-trifluoro-6-methylnaphthalen-2-yl)oxane |
|---|---|
| PubChem CID | 118900621 |
| Molecular Formula | C23H16F8O2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-(1,7,8-trifluoro-6-methylnaphthalen-2-yl)oxane |
| SMILES | Cc1cc2ccc(C3CCC(C(F)(F)Oc4cc(F)c(F)c(F)c4)OC3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C23H16F8O2/c1-10-6-11-2-4-14(20(27)18(11)22(29)19(10)26)12-3-5-17(32-9-12)23(30,31)33-13-7-15(24)21(28)16(25)8-13/h2,4,6-8,12,17H,3,5,9H2,1H3 |
| InChIKey | ZSGPAEXILKRZFU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|