C14H16F4O2 — CID 58555668
2-[(3,4-difluorophenoxy)-difluoromethyl]-5-propyloxolane (PubChem CID 58555668) has the molecular formula C14H16F4O2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-[(3,4-difluorophenoxy)-difluoromethyl]-5-propyloxolane.
| Compound Name | 2-[(3,4-difluorophenoxy)-difluoromethyl]-5-propyloxolane |
|---|---|
| PubChem CID | 58555668 |
| Molecular Formula | C14H16F4O2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[(3,4-difluorophenoxy)-difluoromethyl]-5-propyloxolane |
| SMILES | CCCC1CCC(C(F)(F)Oc2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C14H16F4O2/c1-2-3-9-5-7-13(19-9)14(17,18)20-10-4-6-11(15)12(16)8-10/h4,6,8-9,13H,2-3,5,7H2,1H3 |
| InChIKey | CNPYJWCLKIDUMQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |