C11H21NO2 — CID 118901766
6-(1,1-dideuterio-2,2-dimethylpropyl)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole (PubChem CID 118901766) has the molecular formula C11H21NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 6-(1,1-dideuterio-2,2-dimethylpropyl)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole.
| Compound Name | 6-(1,1-dideuterio-2,2-dimethylpropyl)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 118901766 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 6-(1,1-dideuterio-2,2-dimethylpropyl)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
| SMILES | [2H]C([2H])(N1CC2OCCOC2C1)C(C)(C)C |
| InChI | InChI=1S/C11H21NO2/c1-11(2,3)8-12-6-9-10(7-12)14-5-4-13-9/h9-10H,4-8H2,1-3H3/i8D2 |
| InChIKey | WDHDIVBEMOWPRP-MGVXTIMCSA-N |
| XLogP | 1.13 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |