C18H25N — CID 118903083
(1Z,3Z)-N,2-dimethyl-3-(2-methylpropyl)-5-phenylhexa-1,3,5-trien-1-amine (PubChem CID 118903083) has the molecular formula C18H25N and a molecular weight of 255.41 g/mol. Its IUPAC name is (1Z,3Z)-N,2-dimethyl-3-(2-methylpropyl)-5-phenylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N,2-dimethyl-3-(2-methylpropyl)-5-phenylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 118903083 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | (1Z,3Z)-N,2-dimethyl-3-(2-methylpropyl)-5-phenylhexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C(CC(C)C)\C(C)=C/NC)c1ccccc1 |
| InChI | InChI=1S/C18H25N/c1-14(2)11-18(16(4)13-19-5)12-15(3)17-9-7-6-8-10-17/h6-10,12-14,19H,3,11H2,1-2,4-5H3/b16-13-,18-12- |
| InChIKey | RTEIADXUBJSBAT-UJZUQUBNSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|